C21H29N3OS2 — CID 19372992
(NE)-N-[1-[5-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propylsulfanyl]thiophen-2-yl]ethylidene]hydroxylamine (PubChem CID 19372992) has the molecular formula C21H29N3OS2 and a molecular weight of 403.62 g/mol. Its IUPAC name is (NE)-N-[1-[5-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propylsulfanyl]thiophen-2-yl]ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[5-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propylsulfanyl]thiophen-2-yl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 19372992 |
| Molecular Formula | C21H29N3OS2 |
| Molecular Weight | 403.62 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | (NE)-N-[1-[5-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propylsulfanyl]thiophen-2-yl]ethylidene]hydroxylamine |
| SMILES | C/C(=N\O)c1ccc(SCCCN2CCN(c3cccc(C)c3C)CC2)s1 |
| InChI | InChI=1S/C21H29N3OS2/c1-16-6-4-7-19(17(16)2)24-13-11-23(12-14-24)10-5-15-26-21-9-8-20(27-21)18(3)22-25/h4,6-9,25H,5,10-15H2,1-3H3/b22-18+ |
| InChIKey | JPSAXXJWOZSBAM-RELWKKBWSA-N |
| XLogP | 4.87 |
| TPSA | 39.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.62 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|