C16H26N2O2 — CID 61071831
2-[2-[4-(2,3-dimethylphenyl)piperazin-1-yl]ethoxy]ethanol (PubChem CID 61071831) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-[2-[4-(2,3-dimethylphenyl)piperazin-1-yl]ethoxy]ethanol.
| Compound Name | 2-[2-[4-(2,3-dimethylphenyl)piperazin-1-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 61071831 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 2-[2-[4-(2,3-dimethylphenyl)piperazin-1-yl]ethoxy]ethanol |
| SMILES | Cc1cccc(N2CCN(CCOCCO)CC2)c1C |
| InChI | InChI=1S/C16H26N2O2/c1-14-4-3-5-16(15(14)2)18-8-6-17(7-9-18)10-12-20-13-11-19/h3-5,19H,6-13H2,1-2H3 |
| InChIKey | YFHDLBLZCWZHNT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|