C18H24N4 — CID 83970373
5-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-methylpyridin-2-amine (PubChem CID 83970373) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is 5-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-methylpyridin-2-amine.
| Compound Name | 5-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-methylpyridin-2-amine |
|---|---|
| PubChem CID | 83970373 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 5-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-methylpyridin-2-amine |
| SMILES | Cc1cc(N2CCN(c3cccc(C)c3C)CC2)cnc1N |
| InChI | InChI=1S/C18H24N4/c1-13-5-4-6-17(15(13)3)22-9-7-21(8-10-22)16-11-14(2)18(19)20-12-16/h4-6,11-12H,7-10H2,1-3H3,(H2,19,20) |
| InChIKey | SJYOIMJKNCQMFR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |