C16H19ClN4 — CID 83970369
5-[4-(3-chlorophenyl)piperazin-1-yl]-3-methylpyridin-2-amine (PubChem CID 83970369) has the molecular formula C16H19ClN4 and a molecular weight of 302.81 g/mol. Its IUPAC name is 5-[4-(3-chlorophenyl)piperazin-1-yl]-3-methylpyridin-2-amine.
| Compound Name | 5-[4-(3-chlorophenyl)piperazin-1-yl]-3-methylpyridin-2-amine |
|---|---|
| PubChem CID | 83970369 |
| Molecular Formula | C16H19ClN4 |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 5-[4-(3-chlorophenyl)piperazin-1-yl]-3-methylpyridin-2-amine |
| SMILES | Cc1cc(N2CCN(c3cccc(Cl)c3)CC2)cnc1N |
| InChI | InChI=1S/C16H19ClN4/c1-12-9-15(11-19-16(12)18)21-7-5-20(6-8-21)14-4-2-3-13(17)10-14/h2-4,9-11H,5-8H2,1H3,(H2,18,19) |
| InChIKey | ADOCHHCXFVHRRM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |