C14H16ClN5 — CID 79910450
4-[4-(3-chlorophenyl)piperazin-1-yl]pyrimidin-5-amine (PubChem CID 79910450) has the molecular formula C14H16ClN5 and a molecular weight of 289.77 g/mol. Its IUPAC name is 4-[4-(3-chlorophenyl)piperazin-1-yl]pyrimidin-5-amine.
| Compound Name | 4-[4-(3-chlorophenyl)piperazin-1-yl]pyrimidin-5-amine |
|---|---|
| PubChem CID | 79910450 |
| Molecular Formula | C14H16ClN5 |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 4-[4-(3-chlorophenyl)piperazin-1-yl]pyrimidin-5-amine |
| SMILES | Nc1cncnc1N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C14H16ClN5/c15-11-2-1-3-12(8-11)19-4-6-20(7-5-19)14-13(16)9-17-10-18-14/h1-3,8-10H,4-7,16H2 |
| InChIKey | IHUAZNZJARNJPK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |