C13H20N6O — CID 122098254
N'-(3-hydroxycyclobutyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 122098254) has the molecular formula C13H20N6O and a molecular weight of 276.34 g/mol. Its IUPAC name is N'-(3-hydroxycyclobutyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-(3-hydroxycyclobutyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 122098254 |
| Molecular Formula | C13H20N6O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | N'-(3-hydroxycyclobutyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | N/C(=N\C1CC(O)C1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C13H20N6O/c14-12(17-10-8-11(20)9-10)18-4-6-19(7-5-18)13-15-2-1-3-16-13/h1-3,10-11,20H,4-9H2,(H2,14,17) |
| InChIKey | MKKORLGORPXWER-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|