C18H19F3N6 — CID 120671406
4-pyrimidin-2-yl-N'-[(1R,2S)-2-(3,4,5-trifluorophenyl)cyclopropyl]piperazine-1-carboximidamide (PubChem CID 120671406) has the molecular formula C18H19F3N6 and a molecular weight of 376.39 g/mol. Its IUPAC name is 4-pyrimidin-2-yl-N'-[(1R,2S)-2-(3,4,5-trifluorophenyl)cyclopropyl]piperazine-1-carboximidamide.
| Compound Name | 4-pyrimidin-2-yl-N'-[(1R,2S)-2-(3,4,5-trifluorophenyl)cyclopropyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 120671406 |
| Molecular Formula | C18H19F3N6 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 4-pyrimidin-2-yl-N'-[(1R,2S)-2-(3,4,5-trifluorophenyl)cyclopropyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\[C@@H]1C[C@H]1c1cc(F)c(F)c(F)c1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H19F3N6/c19-13-8-11(9-14(20)16(13)21)12-10-15(12)25-17(22)26-4-6-27(7-5-26)18-23-2-1-3-24-18/h1-3,8-9,12,15H,4-7,10H2,(H2,22,25)/t12-,15+/m0/s1 |
| InChIKey | JWKLMLVVDZUFEK-SWLSCSKDSA-N |
| XLogP | 1.89 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|