C17H20F2N6 — CID 119121003
N'-[2-(3,5-difluorophenyl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 119121003) has the molecular formula C17H20F2N6 and a molecular weight of 346.38 g/mol. Its IUPAC name is N'-[2-(3,5-difluorophenyl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-[2-(3,5-difluorophenyl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119121003 |
| Molecular Formula | C17H20F2N6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N'-[2-(3,5-difluorophenyl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | N/C(=N\CCc1cc(F)cc(F)c1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H20F2N6/c18-14-10-13(11-15(19)12-14)2-5-21-16(20)24-6-8-25(9-7-24)17-22-3-1-4-23-17/h1,3-4,10-12H,2,5-9H2,(H2,20,21) |
| InChIKey | QHBAIKVXVJZTFV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|