C14H21F2IN6 — CID 120662409
N'-[[1-(difluoromethyl)cyclopropyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 120662409) has the molecular formula C14H21F2IN6 and a molecular weight of 438.26 g/mol. Its IUPAC name is N'-[[1-(difluoromethyl)cyclopropyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[1-(difluoromethyl)cyclopropyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120662409 |
| Molecular Formula | C14H21F2IN6 |
| Molecular Weight | 438.26 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | N'-[[1-(difluoromethyl)cyclopropyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CC1(C(F)F)CC1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C14H20F2N6.HI/c15-11(16)14(2-3-14)10-20-12(17)21-6-8-22(9-7-21)13-18-4-1-5-19-13;/h1,4-5,11H,2-3,6-10H2,(H2,17,20);1H |
| InChIKey | RNGOKGLFQQBWCO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|