C14H23IN6S — CID 120605910
N'-[(1-methylsulfanylcyclopropyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 120605910) has the molecular formula C14H23IN6S and a molecular weight of 434.35 g/mol. Its IUPAC name is N'-[(1-methylsulfanylcyclopropyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(1-methylsulfanylcyclopropyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120605910 |
| Molecular Formula | C14H23IN6S |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | N'-[(1-methylsulfanylcyclopropyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CSC1(C/N=C(\N)N2CCN(c3ncccn3)CC2)CC1.I |
| InChI | InChI=1S/C14H22N6S.HI/c1-21-14(3-4-14)11-18-12(15)19-7-9-20(10-8-19)13-16-5-2-6-17-13;/h2,5-6H,3-4,7-11H2,1H3,(H2,15,18);1H |
| InChIKey | HFZHBRIBTWJRHB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|