C15H26IN7 — CID 119120397
N'-[2-[cyclopropyl(methyl)amino]ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 119120397) has the molecular formula C15H26IN7 and a molecular weight of 431.33 g/mol. Its IUPAC name is N'-[2-[cyclopropyl(methyl)amino]ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-[cyclopropyl(methyl)amino]ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119120397 |
| Molecular Formula | C15H26IN7 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | N'-[2-[cyclopropyl(methyl)amino]ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CN(CC/N=C(\N)N1CCN(c2ncccn2)CC1)C1CC1.I |
| InChI | InChI=1S/C15H25N7.HI/c1-20(13-3-4-13)8-7-17-14(16)21-9-11-22(12-10-21)15-18-5-2-6-19-15;/h2,5-6,13H,3-4,7-12H2,1H3,(H2,16,17);1H |
| InChIKey | OIKFASBOJPNZII-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|