C17H26N6O — CID 122098681
N'-[2-(7-oxabicyclo[2.2.1]heptan-2-yl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 122098681) has the molecular formula C17H26N6O and a molecular weight of 330.44 g/mol. Its IUPAC name is N'-[2-(7-oxabicyclo[2.2.1]heptan-2-yl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-[2-(7-oxabicyclo[2.2.1]heptan-2-yl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 122098681 |
| Molecular Formula | C17H26N6O |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | N'-[2-(7-oxabicyclo[2.2.1]heptan-2-yl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | N/C(=N\CCC1CC2CCC1O2)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H26N6O/c18-16(19-7-4-13-12-14-2-3-15(13)24-14)22-8-10-23(11-9-22)17-20-5-1-6-21-17/h1,5-6,13-15H,2-4,7-12H2,(H2,18,19) |
| InChIKey | VCUHSRXMCFDLJK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|