C16H27N7O — CID 122082011
N'-[2-(1,4-oxazepan-4-yl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 122082011) has the molecular formula C16H27N7O and a molecular weight of 333.44 g/mol. Its IUPAC name is N'-[2-(1,4-oxazepan-4-yl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-[2-(1,4-oxazepan-4-yl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 122082011 |
| Molecular Formula | C16H27N7O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | N'-[2-(1,4-oxazepan-4-yl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | N/C(=N\CCN1CCCOCC1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C16H27N7O/c17-15(18-5-7-21-6-2-13-24-14-12-21)22-8-10-23(11-9-22)16-19-3-1-4-20-16/h1,3-4H,2,5-14H2,(H2,17,18) |
| InChIKey | GRMYYIUNTIZHTB-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 83.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|