C11H23IN4OS — CID 111024484
N'-(2-morpholin-4-ylethyl)thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 111024484) has the molecular formula C11H23IN4OS and a molecular weight of 386.30 g/mol. Its IUPAC name is N'-(2-morpholin-4-ylethyl)thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-(2-morpholin-4-ylethyl)thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111024484 |
| Molecular Formula | C11H23IN4OS |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | N'-(2-morpholin-4-ylethyl)thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCN1CCOCC1)N1CCSCC1 |
| InChI | InChI=1S/C11H22N4OS.HI/c12-11(15-5-9-17-10-6-15)13-1-2-14-3-7-16-8-4-14;/h1-10H2,(H2,12,13);1H |
| InChIKey | LECDVMKGGAVDTC-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|