C13H25IN4OS — CID 120558136
N'-[(1-morpholin-4-ylcyclopropyl)methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 120558136) has the molecular formula C13H25IN4OS and a molecular weight of 412.34 g/mol. Its IUPAC name is N'-[(1-morpholin-4-ylcyclopropyl)methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[(1-morpholin-4-ylcyclopropyl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120558136 |
| Molecular Formula | C13H25IN4OS |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | N'-[(1-morpholin-4-ylcyclopropyl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CC1(N2CCOCC2)CC1)N1CCSCC1 |
| InChI | InChI=1S/C13H24N4OS.HI/c14-12(16-5-9-19-10-6-16)15-11-13(1-2-13)17-3-7-18-8-4-17;/h1-11H2,(H2,14,15);1H |
| InChIKey | CTWOUXSLSADWAY-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|