C13H26IN3O3S — CID 120762790
N'-[[4-(2-hydroxyethoxy)oxan-4-yl]methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 120762790) has the molecular formula C13H26IN3O3S and a molecular weight of 431.34 g/mol. Its IUPAC name is N'-[[4-(2-hydroxyethoxy)oxan-4-yl]methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[[4-(2-hydroxyethoxy)oxan-4-yl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120762790 |
| Molecular Formula | C13H26IN3O3S |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | N'-[[4-(2-hydroxyethoxy)oxan-4-yl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CC1(OCCO)CCOCC1)N1CCSCC1 |
| InChI | InChI=1S/C13H25N3O3S.HI/c14-12(16-3-9-20-10-4-16)15-11-13(19-8-5-17)1-6-18-7-2-13;/h17H,1-11H2,(H2,14,15);1H |
| InChIKey | RUSNLMGWFVWLNV-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|