C10H16F3N3S — CID 120973293
N'-[[1-(trifluoromethyl)cyclopropyl]methyl]thiomorpholine-4-carboximidamide (PubChem CID 120973293) has the molecular formula C10H16F3N3S and a molecular weight of 267.32 g/mol. Its IUPAC name is N'-[[1-(trifluoromethyl)cyclopropyl]methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[[1-(trifluoromethyl)cyclopropyl]methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 120973293 |
| Molecular Formula | C10H16F3N3S |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N'-[[1-(trifluoromethyl)cyclopropyl]methyl]thiomorpholine-4-carboximidamide |
| SMILES | N/C(=N\CC1(C(F)(F)F)CC1)N1CCSCC1 |
| InChI | InChI=1S/C10H16F3N3S/c11-10(12,13)9(1-2-9)7-15-8(14)16-3-5-17-6-4-16/h1-7H2,(H2,14,15) |
| InChIKey | PQQLXVGXIORETN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|