C10H20IN3S — CID 119120257
N'-(2,2-dimethylcyclopropyl)thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 119120257) has the molecular formula C10H20IN3S and a molecular weight of 341.26 g/mol. Its IUPAC name is N'-(2,2-dimethylcyclopropyl)thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-(2,2-dimethylcyclopropyl)thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119120257 |
| Molecular Formula | C10H20IN3S |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | N'-(2,2-dimethylcyclopropyl)thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CC1(C)CC1/N=C(\N)N1CCSCC1.I |
| InChI | InChI=1S/C10H19N3S.HI/c1-10(2)7-8(10)12-9(11)13-3-5-14-6-4-13;/h8H,3-7H2,1-2H3,(H2,11,12);1H |
| InChIKey | CLANRYIQBLTSGM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|