C11H22IN3O2S — CID 110033020
N'-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 110033020) has the molecular formula C11H22IN3O2S and a molecular weight of 387.29 g/mol. Its IUPAC name is N'-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110033020 |
| Molecular Formula | C11H22IN3O2S |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | N'-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CC1(CC/N=C(\N)N2CCSCC2)OCCO1.I |
| InChI | InChI=1S/C11H21N3O2S.HI/c1-11(15-6-7-16-11)2-3-13-10(12)14-4-8-17-9-5-14;/h2-9H2,1H3,(H2,12,13);1H |
| InChIKey | ZBAPPVGNNSWVQS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|