C16H33IN6S2 — CID 110062202
N'-[6-[[amino(thiomorpholin-4-yl)methylidene]amino]hexyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 110062202) has the molecular formula C16H33IN6S2 and a molecular weight of 500.52 g/mol. Its IUPAC name is N'-[6-[[amino(thiomorpholin-4-yl)methylidene]amino]hexyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[6-[[amino(thiomorpholin-4-yl)methylidene]amino]hexyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110062202 |
| Molecular Formula | C16H33IN6S2 |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | N'-[6-[[amino(thiomorpholin-4-yl)methylidene]amino]hexyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCCCCC/N=C(\N)N1CCSCC1)N1CCSCC1 |
| InChI | InChI=1S/C16H32N6S2.HI/c17-15(21-7-11-23-12-8-21)19-5-3-1-2-4-6-20-16(18)22-9-13-24-14-10-22;/h1-14H2,(H2,17,19)(H2,18,20);1H |
| InChIKey | MGTCQGVFKDSNGG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 83.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|