C14H29N5S — CID 111091688
N'-[3-(4-methyl-1,4-diazepan-1-yl)propyl]thiomorpholine-4-carboximidamide (PubChem CID 111091688) has the molecular formula C14H29N5S and a molecular weight of 299.49 g/mol. Its IUPAC name is N'-[3-(4-methyl-1,4-diazepan-1-yl)propyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[3-(4-methyl-1,4-diazepan-1-yl)propyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111091688 |
| Molecular Formula | C14H29N5S |
| Molecular Weight | 299.49 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | N'-[3-(4-methyl-1,4-diazepan-1-yl)propyl]thiomorpholine-4-carboximidamide |
| SMILES | CN1CCCN(CCC/N=C(\N)N2CCSCC2)CC1 |
| InChI | InChI=1S/C14H29N5S/c1-17-5-3-7-18(9-8-17)6-2-4-16-14(15)19-10-12-20-13-11-19/h2-13H2,1H3,(H2,15,16) |
| InChIKey | KKQRXTKEBVZDAG-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 48.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.49 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|