C14H28N4S — CID 111034887
N'-[3-(4-methylpiperidin-1-yl)propyl]thiomorpholine-4-carboximidamide (PubChem CID 111034887) has the molecular formula C14H28N4S and a molecular weight of 284.47 g/mol. Its IUPAC name is N'-[3-(4-methylpiperidin-1-yl)propyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[3-(4-methylpiperidin-1-yl)propyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111034887 |
| Molecular Formula | C14H28N4S |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | N'-[3-(4-methylpiperidin-1-yl)propyl]thiomorpholine-4-carboximidamide |
| SMILES | CC1CCN(CCC/N=C(\N)N2CCSCC2)CC1 |
| InChI | InChI=1S/C14H28N4S/c1-13-3-7-17(8-4-13)6-2-5-16-14(15)18-9-11-19-12-10-18/h13H,2-12H2,1H3,(H2,15,16) |
| InChIKey | ATCSHMUYSKHKMD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|