C18H37IN4 — CID 110920087
N'-[4-(3,5-dimethylpiperidin-1-yl)butyl]-4-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 110920087) has the molecular formula C18H37IN4 and a molecular weight of 436.43 g/mol. Its IUPAC name is N'-[4-(3,5-dimethylpiperidin-1-yl)butyl]-4-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[4-(3,5-dimethylpiperidin-1-yl)butyl]-4-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110920087 |
| Molecular Formula | C18H37IN4 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | N'-[4-(3,5-dimethylpiperidin-1-yl)butyl]-4-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CC1CCN(/C(N)=N/CCCCN2CC(C)CC(C)C2)CC1.I |
| InChI | InChI=1S/C18H36N4.HI/c1-15-6-10-22(11-7-15)18(19)20-8-4-5-9-21-13-16(2)12-17(3)14-21;/h15-17H,4-14H2,1-3H3,(H2,19,20);1H |
| InChIKey | WDFMCARQTRCVNT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|