C11H23N3OS — CID 111087620
N'-(5-methoxypentyl)thiomorpholine-4-carboximidamide (PubChem CID 111087620) has the molecular formula C11H23N3OS and a molecular weight of 245.39 g/mol. Its IUPAC name is N'-(5-methoxypentyl)thiomorpholine-4-carboximidamide.
| Compound Name | N'-(5-methoxypentyl)thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111087620 |
| Molecular Formula | C11H23N3OS |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | N'-(5-methoxypentyl)thiomorpholine-4-carboximidamide |
| SMILES | COCCCCC/N=C(\N)N1CCSCC1 |
| InChI | InChI=1S/C11H23N3OS/c1-15-8-4-2-3-5-13-11(12)14-6-9-16-10-7-14/h2-10H2,1H3,(H2,12,13) |
| InChIKey | AAFGASKIGUQMRR-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|