C20H40N6 — CID 110062207
N'-[6-[[amino(azepan-1-yl)methylidene]amino]hexyl]azepane-1-carboximidamide (PubChem CID 110062207) has the molecular formula C20H40N6 and a molecular weight of 364.58 g/mol. Its IUPAC name is N'-[6-[[amino(azepan-1-yl)methylidene]amino]hexyl]azepane-1-carboximidamide.
| Compound Name | N'-[6-[[amino(azepan-1-yl)methylidene]amino]hexyl]azepane-1-carboximidamide |
|---|---|
| PubChem CID | 110062207 |
| Molecular Formula | C20H40N6 |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.33 |
| IUPAC Name | N'-[6-[[amino(azepan-1-yl)methylidene]amino]hexyl]azepane-1-carboximidamide |
| SMILES | N/C(=N\CCCCCC/N=C(\N)N1CCCCCC1)N1CCCCCC1 |
| InChI | InChI=1S/C20H40N6/c21-19(25-15-9-3-4-10-16-25)23-13-7-1-2-8-14-24-20(22)26-17-11-5-6-12-18-26/h1-18H2,(H2,21,23)(H2,22,24) |
| InChIKey | HHWAOWDRSLWNRO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 83.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|