C11H24N4S — CID 111022719
N'-[2-(diethylamino)ethyl]thiomorpholine-4-carboximidamide (PubChem CID 111022719) has the molecular formula C11H24N4S and a molecular weight of 244.41 g/mol. Its IUPAC name is N'-[2-(diethylamino)ethyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[2-(diethylamino)ethyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111022719 |
| Molecular Formula | C11H24N4S |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | N'-[2-(diethylamino)ethyl]thiomorpholine-4-carboximidamide |
| SMILES | CCN(CC)CC/N=C(\N)N1CCSCC1 |
| InChI | InChI=1S/C11H24N4S/c1-3-14(4-2)6-5-13-11(12)15-7-9-16-10-8-15/h3-10H2,1-2H3,(H2,12,13) |
| InChIKey | AFLGSJFWOPXPQG-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|