C15H30N4O2S — CID 109377923
tert-butyl N-[2-[[amino(thiomorpholin-4-yl)methylidene]amino]ethyl]-N-propylcarbamate (PubChem CID 109377923) has the molecular formula C15H30N4O2S and a molecular weight of 330.50 g/mol. Its IUPAC name is tert-butyl N-[2-[[amino(thiomorpholin-4-yl)methylidene]amino]ethyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[2-[[amino(thiomorpholin-4-yl)methylidene]amino]ethyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 109377923 |
| Molecular Formula | C15H30N4O2S |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | tert-butyl N-[2-[[amino(thiomorpholin-4-yl)methylidene]amino]ethyl]-N-propylcarbamate |
| SMILES | CCCN(CC/N=C(\N)N1CCSCC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H30N4O2S/c1-5-7-19(14(20)21-15(2,3)4)8-6-17-13(16)18-9-11-22-12-10-18/h5-12H2,1-4H3,(H2,16,17) |
| InChIKey | LAMUSIIUVQQYLD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|