C15H29IN4O2S — CID 111097600
tert-butyl N-[2-[[amino(thiomorpholin-4-yl)methylidene]amino]ethyl]-N-cyclopropylcarbamate;hydroiodide (PubChem CID 111097600) has the molecular formula C15H29IN4O2S and a molecular weight of 456.39 g/mol. Its IUPAC name is tert-butyl N-[2-[[amino(thiomorpholin-4-yl)methylidene]amino]ethyl]-N-cyclopropylcarbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[amino(thiomorpholin-4-yl)methylidene]amino]ethyl]-N-cyclopropylcarbamate;hydroiodide |
|---|---|
| PubChem CID | 111097600 |
| Molecular Formula | C15H29IN4O2S |
| Molecular Weight | 456.39 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | tert-butyl N-[2-[[amino(thiomorpholin-4-yl)methylidene]amino]ethyl]-N-cyclopropylcarbamate;hydroiodide |
| SMILES | CC(C)(C)OC(=O)N(CC/N=C(\N)N1CCSCC1)C1CC1.I |
| InChI | InChI=1S/C15H28N4O2S.HI/c1-15(2,3)21-14(20)19(12-4-5-12)7-6-17-13(16)18-8-10-22-11-9-18;/h12H,4-11H2,1-3H3,(H2,16,17);1H |
| InChIKey | KDMJIULGWFFRDT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|