C11H21N3O2S — CID 111801462
tert-butyl 2-[[amino(thiomorpholin-4-yl)methylidene]amino]acetate (PubChem CID 111801462) has the molecular formula C11H21N3O2S and a molecular weight of 259.37 g/mol. Its IUPAC name is tert-butyl 2-[[amino(thiomorpholin-4-yl)methylidene]amino]acetate.
| Compound Name | tert-butyl 2-[[amino(thiomorpholin-4-yl)methylidene]amino]acetate |
|---|---|
| PubChem CID | 111801462 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | tert-butyl 2-[[amino(thiomorpholin-4-yl)methylidene]amino]acetate |
| SMILES | CC(C)(C)OC(=O)C/N=C(\N)N1CCSCC1 |
| InChI | InChI=1S/C11H21N3O2S/c1-11(2,3)16-9(15)8-13-10(12)14-4-6-17-7-5-14/h4-8H2,1-3H3,(H2,12,13) |
| InChIKey | FFDBNDZXRHWZRY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|