C11H23N3O2S2 — CID 111812180
N'-(2-tert-butylsulfonylethyl)thiomorpholine-4-carboximidamide (PubChem CID 111812180) has the molecular formula C11H23N3O2S2 and a molecular weight of 293.46 g/mol. Its IUPAC name is N'-(2-tert-butylsulfonylethyl)thiomorpholine-4-carboximidamide.
| Compound Name | N'-(2-tert-butylsulfonylethyl)thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111812180 |
| Molecular Formula | C11H23N3O2S2 |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N'-(2-tert-butylsulfonylethyl)thiomorpholine-4-carboximidamide |
| SMILES | CC(C)(C)S(=O)(=O)CC/N=C(\N)N1CCSCC1 |
| InChI | InChI=1S/C11H23N3O2S2/c1-11(2,3)18(15,16)9-4-13-10(12)14-5-7-17-8-6-14/h4-9H2,1-3H3,(H2,12,13) |
| InChIKey | BCHFZHHKNUUXFX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|