C13H19BrIN3O2S2 — CID 111807903
N'-[2-(4-bromophenyl)sulfonylethyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 111807903) has the molecular formula C13H19BrIN3O2S2 and a molecular weight of 520.26 g/mol. Its IUPAC name is N'-[2-(4-bromophenyl)sulfonylethyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(4-bromophenyl)sulfonylethyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111807903 |
| Molecular Formula | C13H19BrIN3O2S2 |
| Molecular Weight | 520.26 g/mol |
| Exact Mass | 518.91 |
| IUPAC Name | N'-[2-(4-bromophenyl)sulfonylethyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCS(=O)(=O)c1ccc(Br)cc1)N1CCSCC1 |
| InChI | InChI=1S/C13H18BrN3O2S2.HI/c14-11-1-3-12(4-2-11)21(18,19)10-5-16-13(15)17-6-8-20-9-7-17;/h1-4H,5-10H2,(H2,15,16);1H |
| InChIKey | WWBQTFAGRYOSMB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|