C15H23BrIN3S — CID 111070123
N'-[2-(4-bromophenyl)-2-methylpropyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 111070123) has the molecular formula C15H23BrIN3S and a molecular weight of 484.25 g/mol. Its IUPAC name is N'-[2-(4-bromophenyl)-2-methylpropyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(4-bromophenyl)-2-methylpropyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111070123 |
| Molecular Formula | C15H23BrIN3S |
| Molecular Weight | 484.25 g/mol |
| Exact Mass | 482.98 |
| IUPAC Name | N'-[2-(4-bromophenyl)-2-methylpropyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CC(C)(C/N=C(\N)N1CCSCC1)c1ccc(Br)cc1.I |
| InChI | InChI=1S/C15H22BrN3S.HI/c1-15(2,12-3-5-13(16)6-4-12)11-18-14(17)19-7-9-20-10-8-19;/h3-6H,7-11H2,1-2H3,(H2,17,18);1H |
| InChIKey | DVCKHHUCFBFZPG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.25 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|