C12H25N3S2 — CID 119148422
N'-(2-ethyl-2-methylsulfanylbutyl)thiomorpholine-4-carboximidamide (PubChem CID 119148422) has the molecular formula C12H25N3S2 and a molecular weight of 275.49 g/mol. Its IUPAC name is N'-(2-ethyl-2-methylsulfanylbutyl)thiomorpholine-4-carboximidamide.
| Compound Name | N'-(2-ethyl-2-methylsulfanylbutyl)thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 119148422 |
| Molecular Formula | C12H25N3S2 |
| Molecular Weight | 275.49 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N'-(2-ethyl-2-methylsulfanylbutyl)thiomorpholine-4-carboximidamide |
| SMILES | CCC(CC)(C/N=C(\N)N1CCSCC1)SC |
| InChI | InChI=1S/C12H25N3S2/c1-4-12(5-2,16-3)10-14-11(13)15-6-8-17-9-7-15/h4-10H2,1-3H3,(H2,13,14) |
| InChIKey | BAJIUOCRVWXRRI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|