C14H29IN4S — CID 75534648
N'-(2-methyl-3-piperidin-1-ylpropyl)thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 75534648) has the molecular formula C14H29IN4S and a molecular weight of 412.39 g/mol. Its IUPAC name is N'-(2-methyl-3-piperidin-1-ylpropyl)thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-(2-methyl-3-piperidin-1-ylpropyl)thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 75534648 |
| Molecular Formula | C14H29IN4S |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N'-(2-methyl-3-piperidin-1-ylpropyl)thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CC(C/N=C(\N)N1CCSCC1)CN1CCCCC1.I |
| InChI | InChI=1S/C14H28N4S.HI/c1-13(12-17-5-3-2-4-6-17)11-16-14(15)18-7-9-19-10-8-18;/h13H,2-12H2,1H3,(H2,15,16);1H |
| InChIKey | OWQSZKYWHLJVAF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|