C13H27N5S — CID 111090433
N'-[2-(4-methylpiperazin-1-yl)propyl]thiomorpholine-4-carboximidamide (PubChem CID 111090433) has the molecular formula C13H27N5S and a molecular weight of 285.46 g/mol. Its IUPAC name is N'-[2-(4-methylpiperazin-1-yl)propyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[2-(4-methylpiperazin-1-yl)propyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111090433 |
| Molecular Formula | C13H27N5S |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | N'-[2-(4-methylpiperazin-1-yl)propyl]thiomorpholine-4-carboximidamide |
| SMILES | CC(C/N=C(\N)N1CCSCC1)N1CCN(C)CC1 |
| InChI | InChI=1S/C13H27N5S/c1-12(17-5-3-16(2)4-6-17)11-15-13(14)18-7-9-19-10-8-18/h12H,3-11H2,1-2H3,(H2,14,15) |
| InChIKey | PUPFANCBDGDDQF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 48.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|