C15H30N4OS — CID 111041535
N'-(4-methyl-2-morpholin-4-ylpentyl)thiomorpholine-4-carboximidamide (PubChem CID 111041535) has the molecular formula C15H30N4OS and a molecular weight of 314.50 g/mol. Its IUPAC name is N'-(4-methyl-2-morpholin-4-ylpentyl)thiomorpholine-4-carboximidamide.
| Compound Name | N'-(4-methyl-2-morpholin-4-ylpentyl)thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111041535 |
| Molecular Formula | C15H30N4OS |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | N'-(4-methyl-2-morpholin-4-ylpentyl)thiomorpholine-4-carboximidamide |
| SMILES | CC(C)CC(C/N=C(\N)N1CCSCC1)N1CCOCC1 |
| InChI | InChI=1S/C15H30N4OS/c1-13(2)11-14(18-3-7-20-8-4-18)12-17-15(16)19-5-9-21-10-6-19/h13-14H,3-12H2,1-2H3,(H2,16,17) |
| InChIKey | NAQOBDPLFUSDLW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|