C12H24N4O2 — CID 111055185
N'-(2-morpholin-4-ylpropyl)morpholine-4-carboximidamide (PubChem CID 111055185) has the molecular formula C12H24N4O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is N'-(2-morpholin-4-ylpropyl)morpholine-4-carboximidamide.
| Compound Name | N'-(2-morpholin-4-ylpropyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111055185 |
| Molecular Formula | C12H24N4O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | N'-(2-morpholin-4-ylpropyl)morpholine-4-carboximidamide |
| SMILES | CC(C/N=C(\N)N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C12H24N4O2/c1-11(15-2-6-17-7-3-15)10-14-12(13)16-4-8-18-9-5-16/h11H,2-10H2,1H3,(H2,13,14) |
| InChIKey | XJZDTQLKXSXZFO-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|