C16H24N4O — CID 111067772
N'-[2-(2,3-dihydroindol-1-yl)propyl]morpholine-4-carboximidamide (PubChem CID 111067772) has the molecular formula C16H24N4O and a molecular weight of 288.40 g/mol. Its IUPAC name is N'-[2-(2,3-dihydroindol-1-yl)propyl]morpholine-4-carboximidamide.
| Compound Name | N'-[2-(2,3-dihydroindol-1-yl)propyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111067772 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | N'-[2-(2,3-dihydroindol-1-yl)propyl]morpholine-4-carboximidamide |
| SMILES | CC(C/N=C(\N)N1CCOCC1)N1CCc2ccccc21 |
| InChI | InChI=1S/C16H24N4O/c1-13(12-18-16(17)19-8-10-21-11-9-19)20-7-6-14-4-2-3-5-15(14)20/h2-5,13H,6-12H2,1H3,(H2,17,18) |
| InChIKey | CQCHMLUENQCILD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|