C17H29IN4S — CID 111343888
2-[2-(2,3-dihydroindol-1-yl)propyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111343888) has the molecular formula C17H29IN4S and a molecular weight of 448.42 g/mol. Its IUPAC name is 2-[2-(2,3-dihydroindol-1-yl)propyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(2,3-dihydroindol-1-yl)propyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111343888 |
| Molecular Formula | C17H29IN4S |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 2-[2-(2,3-dihydroindol-1-yl)propyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)N1CCc2ccccc21)NCCSC.I |
| InChI | InChI=1S/C17H28N4S.HI/c1-4-18-17(19-10-12-22-3)20-13-14(2)21-11-9-15-7-5-6-8-16(15)21;/h5-8,14H,4,9-13H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | WWNNFAHGOQDLMP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|