C20H35IN4S — CID 111626977
2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-ethyl-3-(4-methylsulfanylbutyl)guanidine;hydroiodide (PubChem CID 111626977) has the molecular formula C20H35IN4S and a molecular weight of 490.50 g/mol. Its IUPAC name is 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-ethyl-3-(4-methylsulfanylbutyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-ethyl-3-(4-methylsulfanylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111626977 |
| Molecular Formula | C20H35IN4S |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-ethyl-3-(4-methylsulfanylbutyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)N1CCc2ccccc2C1)NCCCCSC.I |
| InChI | InChI=1S/C20H34N4S.HI/c1-4-21-20(22-12-7-8-14-25-3)23-15-17(2)24-13-11-18-9-5-6-10-19(18)16-24;/h5-6,9-10,17H,4,7-8,11-16H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | QWHBWFMKJJREFI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|