C18H33IN4OS — CID 111221856
2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-1-(3-ethoxypropyl)-3-ethylguanidine;hydroiodide (PubChem CID 111221856) has the molecular formula C18H33IN4OS and a molecular weight of 480.46 g/mol. Its IUPAC name is 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-1-(3-ethoxypropyl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-1-(3-ethoxypropyl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111221856 |
| Molecular Formula | C18H33IN4OS |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-1-(3-ethoxypropyl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)N1CCc2sccc2C1)NCCCOCC.I |
| InChI | InChI=1S/C18H32N4OS.HI/c1-4-19-18(20-9-6-11-23-5-2)21-13-15(3)22-10-7-17-16(14-22)8-12-24-17;/h8,12,15H,4-7,9-11,13-14H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | ZWOSZCYXZBWBFN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|