C19H28N4S2 — CID 111350846
2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-1-ethyl-3-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111350846) has the molecular formula C19H28N4S2 and a molecular weight of 376.60 g/mol. Its IUPAC name is 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-1-ethyl-3-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-1-ethyl-3-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111350846 |
| Molecular Formula | C19H28N4S2 |
| Molecular Weight | 376.60 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-1-ethyl-3-(2-thiophen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(C)N1CCc2sccc2C1)NCCc1cccs1 |
| InChI | InChI=1S/C19H28N4S2/c1-3-20-19(21-9-6-17-5-4-11-24-17)22-13-15(2)23-10-7-18-16(14-23)8-12-25-18/h4-5,8,11-12,15H,3,6-7,9-10,13-14H2,1-2H3,(H2,20,21,22) |
| InChIKey | ZYGVTGPHEGHIKY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.60 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|