C19H26N4S — CID 111067338
2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111067338) has the molecular formula C19H26N4S and a molecular weight of 342.51 g/mol. Its IUPAC name is 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111067338 |
| Molecular Formula | C19H26N4S |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-(2-thiophen-2-ylethyl)guanidine |
| SMILES | CC(C/N=C(\N)NCCc1cccs1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H26N4S/c1-15(23-11-9-16-5-2-3-6-17(16)14-23)13-22-19(20)21-10-8-18-7-4-12-24-18/h2-7,12,15H,8-11,13-14H2,1H3,(H3,20,21,22) |
| InChIKey | YPBCORNHHNIILN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|