C21H31IN4O — CID 111355527
2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-ethyl-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 111355527) has the molecular formula C21H31IN4O and a molecular weight of 482.41 g/mol. Its IUPAC name is 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-ethyl-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-ethyl-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111355527 |
| Molecular Formula | C21H31IN4O |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-ethyl-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)N1CCc2ccccc2C1)NCCc1ccco1.I |
| InChI | InChI=1S/C21H30N4O.HI/c1-3-22-21(23-12-10-20-9-6-14-26-20)24-15-17(2)25-13-11-18-7-4-5-8-19(18)16-25;/h4-9,14,17H,3,10-13,15-16H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | XMSLPEPIYQHTBY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 52.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|