C19H31N5OS — CID 111927215
N-[2-[[N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide (PubChem CID 111927215) has the molecular formula C19H31N5OS and a molecular weight of 377.56 g/mol. Its IUPAC name is N-[2-[[N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 111927215 |
| Molecular Formula | C19H31N5OS |
| Molecular Weight | 377.56 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | N-[2-[[N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
| SMILES | CCN/C(=N\CC(C)N1CCc2sccc2C1)NCCNC(=O)C1CC1 |
| InChI | InChI=1S/C19H31N5OS/c1-3-20-19(22-9-8-21-18(25)15-4-5-15)23-12-14(2)24-10-6-17-16(13-24)7-11-26-17/h7,11,14-15H,3-6,8-10,12-13H2,1-2H3,(H,21,25)(H2,20,22,23) |
| InChIKey | SPRAZTFMYMHCCV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.56 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|