C22H33IN4O2S — CID 111200369
1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-[(3,4-dimethoxyphenyl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111200369) has the molecular formula C22H33IN4O2S and a molecular weight of 544.50 g/mol. Its IUPAC name is 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-[(3,4-dimethoxyphenyl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-[(3,4-dimethoxyphenyl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111200369 |
| Molecular Formula | C22H33IN4O2S |
| Molecular Weight | 544.50 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-[(3,4-dimethoxyphenyl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1)NCC(C)N1CCc2sccc2C1.I |
| InChI | InChI=1S/C22H32N4O2S.HI/c1-5-23-22(25-14-17-6-7-19(27-3)20(12-17)28-4)24-13-16(2)26-10-8-21-18(15-26)9-11-29-21;/h6-7,9,11-12,16H,5,8,10,13-15H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | CDRMXEDTYBDXFH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|