C17H28IN3O4 — CID 111201737
methyl 3-[[N'-[(3,4-dimethoxyphenyl)methyl]-N-ethylcarbamimidoyl]amino]-2-methylpropanoate;hydroiodide (PubChem CID 111201737) has the molecular formula C17H28IN3O4 and a molecular weight of 465.33 g/mol. Its IUPAC name is methyl 3-[[N'-[(3,4-dimethoxyphenyl)methyl]-N-ethylcarbamimidoyl]amino]-2-methylpropanoate;hydroiodide.
| Compound Name | methyl 3-[[N'-[(3,4-dimethoxyphenyl)methyl]-N-ethylcarbamimidoyl]amino]-2-methylpropanoate;hydroiodide |
|---|---|
| PubChem CID | 111201737 |
| Molecular Formula | C17H28IN3O4 |
| Molecular Weight | 465.33 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | methyl 3-[[N'-[(3,4-dimethoxyphenyl)methyl]-N-ethylcarbamimidoyl]amino]-2-methylpropanoate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1)NCC(C)C(=O)OC.I |
| InChI | InChI=1S/C17H27N3O4.HI/c1-6-18-17(19-10-12(2)16(21)24-5)20-11-13-7-8-14(22-3)15(9-13)23-4;/h7-9,12H,6,10-11H2,1-5H3,(H2,18,19,20);1H |
| InChIKey | BCSTWQIPLJLQJS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|