C22H34N4O2S — CID 111660381
1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethylguanidine (PubChem CID 111660381) has the molecular formula C22H34N4O2S and a molecular weight of 418.61 g/mol. Its IUPAC name is 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethylguanidine.
| Compound Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111660381 |
| Molecular Formula | C22H34N4O2S |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cc(C)oc1C)NCC(C)N1CCc2sccc2C1 |
| InChI | InChI=1S/C22H34N4O2S/c1-6-23-21(25-14-22(5,27)19-11-16(3)28-17(19)4)24-12-15(2)26-9-7-20-18(13-26)8-10-29-20/h8,10-11,15,27H,6-7,9,12-14H2,1-5H3,(H2,23,24,25) |
| InChIKey | RYJKDEOVNDLSSZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 73.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|