C19H32IN5OS — CID 111011780
N-[2-[[N-ethyl-N'-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide (PubChem CID 111011780) has the molecular formula C19H32IN5OS and a molecular weight of 505.47 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 111011780 |
| Molecular Formula | C19H32IN5OS |
| Molecular Weight | 505.47 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | N-[2-[[N-ethyl-N'-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCCC1)NCCNC(=O)C1CC1.I |
| InChI | InChI=1S/C19H31N5OS.HI/c1-2-20-19(22-10-9-21-18(25)15-7-8-15)23-14-16(17-6-5-13-26-17)24-11-3-4-12-24;/h5-6,13,15-16H,2-4,7-12,14H2,1H3,(H,21,25)(H2,20,22,23);1H |
| InChIKey | NJUZFQZVHBUZSI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|