C23H41IN6OS — CID 111011716
1-[4-[[N-ethyl-N'-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide (PubChem CID 111011716) has the molecular formula C23H41IN6OS and a molecular weight of 576.59 g/mol. Its IUPAC name is 1-[4-[[N-ethyl-N'-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide.
| Compound Name | 1-[4-[[N-ethyl-N'-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111011716 |
| Molecular Formula | C23H41IN6OS |
| Molecular Weight | 576.59 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | 1-[4-[[N-ethyl-N'-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCCC1)NCCCCN1CCC(C(N)=O)CC1.I |
| InChI | InChI=1S/C23H40N6OS.HI/c1-2-25-23(26-11-3-4-12-28-15-9-19(10-16-28)22(24)30)27-18-20(21-8-7-17-31-21)29-13-5-6-14-29;/h7-8,17,19-20H,2-6,9-16,18H2,1H3,(H2,24,30)(H2,25,26,27);1H |
| InChIKey | PYODIEYNDINXIY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.59 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|